2-[1-(dimethylamino)-3-methylcyclopentyl]acetic acid

C10H19NO2 — CID 64527962

IUPAC2-[1-(dimethylamino)-3-methylcyclopentyl]acetic acid
SMILESCC1CCC(CC(=O)O)(N(C)C)C1
InChIInChI=1S/C10H19NO2/c1-8-4-5-10(6-8,11(2)3)7-9(12)13/h8H,4-7H2,1-3H3,(H,12,13)
InChIKeyOIZVKEBOCICOPJ-UHFFFAOYSA-N
MW185.27 g/mol
LogP1.58
Rot. Bonds3

About 2-[1-(dimethylamino)-3-methylcyclopentyl]acetic acid

2-[1-(dimethylamino)-3-methylcyclopentyl]acetic acid (PubChem CID 64527962) has the molecular formula C10H19NO2 and a molecular weight of 185.27 g/mol. Its IUPAC name is 2-[1-(dimethylamino)-3-methylcyclopentyl]acetic acid.

Molecular Properties

Compound Name2-[1-(dimethylamino)-3-methylcyclopentyl]acetic acid
PubChem CID64527962
Molecular FormulaC10H19NO2
Molecular Weight185.27 g/mol
Exact Mass185.14
IUPAC Name2-[1-(dimethylamino)-3-methylcyclopentyl]acetic acid
SMILESCC1CCC(CC(=O)O)(N(C)C)C1
InChIInChI=1S/C10H19NO2/c1-8-4-5-10(6-8,11(2)3)7-9(12)13/h8H,4-7H2,1-3H3,(H,12,13)
InChIKeyOIZVKEBOCICOPJ-UHFFFAOYSA-N
XLogP1.58
TPSA40.54 Ų
H-Bond Donors1
H-Bond Acceptors2
Rotatable Bonds3
Heavy Atoms13
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500185.27
LogP ≤ 51.58
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 102

Analyze 2-[1-(dimethylamino)-3-methylcyclopentyl]acetic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Related Compounds

2-[4-tert-butyl-1-(dimethylamino)cyclohexyl]acetic acid
CID 64526394
2-[4-tert-butyl-1-(dimethylamino)cycloheptyl]acetic acid
CID 65094580
2-[1-(dimethylamino)cycloheptyl]acetic acid
CID 64526393
1-(aminomethyl)-N,N,4-trimethylcyclohexan-1-amine
CID 9161377
2-[1-(diethylamino)-3,4-dimethylcyclohexyl]acetic acid
CID 64745297
2-[(3S)-1-(aminomethyl)-3-methylcyclopentyl]acetic acid
CID 46227593
2-[4-(dimethylamino)-2-propyloxan-4-yl]acetic acid
CID 64526984
2-(1-amino-4-methylcyclohexyl)acetic acid
CID 64664304
2-[1-(azepan-1-yl)-4-methylcyclohexyl]acetic acid
CID 64527329
2-[3-methyl-1-(4-methylpiperazin-1-yl)cyclohexyl]acetic acid
CID 65421643
2-[(1R,3R)-1-benzyl-3-methylcyclopentyl]acetic acid
CID 58626987
2-[3-(dimethylamino)-1-propan-2-ylpyrrolidin-3-yl]acetic acid
CID 64528744

Frequently Asked Questions

What is the IUPAC name of 2-[1-(dimethylamino)-3-methylcyclopentyl]acetic acid?
The IUPAC name of 2-[1-(dimethylamino)-3-methylcyclopentyl]acetic acid (CID 64527962) is 2-[1-(dimethylamino)-3-methylcyclopentyl]acetic acid.
What is the SMILES notation for 2-[1-(dimethylamino)-3-methylcyclopentyl]acetic acid?
The canonical SMILES for 2-[1-(dimethylamino)-3-methylcyclopentyl]acetic acid is CC1CCC(CC(=O)O)(N(C)C)C1.
What is the InChIKey of 2-[1-(dimethylamino)-3-methylcyclopentyl]acetic acid?
The InChIKey is OIZVKEBOCICOPJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H19NO2/c1-8-4-5-10(6-8,11(2)3)7-9(12)13/h8H,4-7H2,1-3H3,(H,12,13).
What are the key properties of 2-[1-(dimethylamino)-3-methylcyclopentyl]acetic acid?
2-[1-(dimethylamino)-3-methylcyclopentyl]acetic acid has a molecular weight of 185.27 g/mol, XLogP of 1.58, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[1-(dimethylamino)-3-methylcyclopentyl]acetic acid is sourced from PubChem (CID 64527962), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).