C23H40O4 — CID 57101491
4-tert-butyl-1-[(4-tert-butylcyclohexyl)-carboxymethyl]cyclohexane-1-carboxylic acid (PubChem CID 57101491) has the molecular formula C23H40O4 and a molecular weight of 380.57 g/mol. Its IUPAC name is 4-tert-butyl-1-[(4-tert-butylcyclohexyl)-carboxymethyl]cyclohexane-1-carboxylic acid.
| Compound Name | 4-tert-butyl-1-[(4-tert-butylcyclohexyl)-carboxymethyl]cyclohexane-1-carboxylic acid |
|---|---|
| PubChem CID | 57101491 |
| Molecular Formula | C23H40O4 |
| Molecular Weight | 380.57 g/mol |
| Exact Mass | 380.29 |
| IUPAC Name | 4-tert-butyl-1-[(4-tert-butylcyclohexyl)-carboxymethyl]cyclohexane-1-carboxylic acid |
| SMILES | CC(C)(C)C1CCC(C(C(=O)O)C2(C(=O)O)CCC(C(C)(C)C)CC2)CC1 |
| InChI | InChI=1S/C23H40O4/c1-21(2,3)16-9-7-15(8-10-16)18(19(24)25)23(20(26)27)13-11-17(12-14-23)22(4,5)6/h15-18H,7-14H2,1-6H3,(H,24,25)(H,26,27) |
| InChIKey | MFINJNAAGUABMS-UHFFFAOYSA-N |
| XLogP | 5.85 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.57 |
| LogP ≤ 5 | 5.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |