C12H22F2O — CID 115694405
1-(4-tert-butylcyclohexyl)-2,2-difluoroethanol (PubChem CID 115694405) has the molecular formula C12H22F2O and a molecular weight of 220.30 g/mol. Its IUPAC name is 1-(4-tert-butylcyclohexyl)-2,2-difluoroethanol.
| Compound Name | 1-(4-tert-butylcyclohexyl)-2,2-difluoroethanol |
|---|---|
| PubChem CID | 115694405 |
| Molecular Formula | C12H22F2O |
| Molecular Weight | 220.30 g/mol |
| Exact Mass | 220.16 |
| IUPAC Name | 1-(4-tert-butylcyclohexyl)-2,2-difluoroethanol |
| SMILES | CC(C)(C)C1CCC(C(O)C(F)F)CC1 |
| InChI | InChI=1S/C12H22F2O/c1-12(2,3)9-6-4-8(5-7-9)10(15)11(13)14/h8-11,15H,4-7H2,1-3H3 |
| InChIKey | CUAPTIGFBKQQOT-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.30 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |