About tert-butylcyclopropane;1-cyclopropylethylcyclopropane
tert-butylcyclopropane;1-cyclopropylethylcyclopropane (PubChem CID 157166349) has the molecular formula C15H28
and a molecular weight of 208.39 g/mol. Its IUPAC name is tert-butylcyclopropane;1-cyclopropylethylcyclopropane.
Molecular Properties
| Compound Name | tert-butylcyclopropane;1-cyclopropylethylcyclopropane |
| PubChem CID | 157166349 |
| Molecular Formula | C15H28 |
| Molecular Weight | 208.39 g/mol |
| Exact Mass | 208.22 |
| IUPAC Name | tert-butylcyclopropane;1-cyclopropylethylcyclopropane |
| SMILES | CC(C)(C)C1CC1.CC(C1CC1)C1CC1 |
| InChI | InChI=1S/C8H14.C7H14/c1-6(7-2-3-7)8-4-5-8;1-7(2,3)6-4-5-6/h6-8H,2-5H2,1H3;6H,4-5H2,1-3H3 |
| InChIKey | AMYNWPKLXHOYMG-UHFFFAOYSA-N |
| XLogP | 4.89 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 208.39 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze tert-butylcyclopropane;1-cyclopropylethylcyclopropane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butylcyclopropane;1-cyclopropylethylcyclopropane?
The IUPAC name of tert-butylcyclopropane;1-cyclopropylethylcyclopropane (CID 157166349) is tert-butylcyclopropane;1-cyclopropylethylcyclopropane.
What is the SMILES notation for tert-butylcyclopropane;1-cyclopropylethylcyclopropane?
The canonical SMILES for tert-butylcyclopropane;1-cyclopropylethylcyclopropane is CC(C)(C)C1CC1.CC(C1CC1)C1CC1.
What is the InChIKey of tert-butylcyclopropane;1-cyclopropylethylcyclopropane?
The InChIKey is AMYNWPKLXHOYMG-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H14.C7H14/c1-6(7-2-3-7)8-4-5-8;1-7(2,3)6-4-5-6/h6-8H,2-5H2,1H3;6H,4-5H2,1-3H3.
What are the key properties of tert-butylcyclopropane;1-cyclopropylethylcyclopropane?
tert-butylcyclopropane;1-cyclopropylethylcyclopropane has a molecular weight of 208.39 g/mol, XLogP of 4.89, 2 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butylcyclopropane;1-cyclopropylethylcyclopropane is sourced from PubChem (CID 157166349), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).