C16H28O2 — CID 101386332
[2-methyl-1-(2,2,3,3-tetramethylcyclopropyl)prop-1-enyl] 2,2-dimethylpropanoate (PubChem CID 101386332) has the molecular formula C16H28O2 and a molecular weight of 252.40 g/mol. Its IUPAC name is [2-methyl-1-(2,2,3,3-tetramethylcyclopropyl)prop-1-enyl] 2,2-dimethylpropanoate.
| Compound Name | [2-methyl-1-(2,2,3,3-tetramethylcyclopropyl)prop-1-enyl] 2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 101386332 |
| Molecular Formula | C16H28O2 |
| Molecular Weight | 252.40 g/mol |
| Exact Mass | 252.21 |
| IUPAC Name | [2-methyl-1-(2,2,3,3-tetramethylcyclopropyl)prop-1-enyl] 2,2-dimethylpropanoate |
| SMILES | CC(C)=C(OC(=O)C(C)(C)C)C1C(C)(C)C1(C)C |
| InChI | InChI=1S/C16H28O2/c1-10(2)11(18-13(17)14(3,4)5)12-15(6,7)16(12,8)9/h12H,1-9H3 |
| InChIKey | OOFUJYXURKCGMA-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.40 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|