About (2-amino-2-methylpropanoyl) 2,2-dimethylpropanoate
(2-amino-2-methylpropanoyl) 2,2-dimethylpropanoate (PubChem CID 163587095) has the molecular formula C9H17NO3
and a molecular weight of 187.24 g/mol. Its IUPAC name is (2-amino-2-methylpropanoyl) 2,2-dimethylpropanoate.
Molecular Properties
| Compound Name | (2-amino-2-methylpropanoyl) 2,2-dimethylpropanoate |
| PubChem CID | 163587095 |
| Molecular Formula | C9H17NO3 |
| Molecular Weight | 187.24 g/mol |
| Exact Mass | 187.12 |
| IUPAC Name | (2-amino-2-methylpropanoyl) 2,2-dimethylpropanoate |
| SMILES | CC(C)(C)C(=O)OC(=O)C(C)(C)N |
| InChI | InChI=1S/C9H17NO3/c1-8(2,3)6(11)13-7(12)9(4,5)10/h10H2,1-5H3 |
| InChIKey | GMJSOJNFYWRNCU-UHFFFAOYSA-N |
| XLogP | 0.84 |
| TPSA | 69.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 187.24 |
| LogP ≤ 5 | 0.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze (2-amino-2-methylpropanoyl) 2,2-dimethylpropanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-amino-2-methylpropanoyl) 2,2-dimethylpropanoate?
The IUPAC name of (2-amino-2-methylpropanoyl) 2,2-dimethylpropanoate (CID 163587095) is (2-amino-2-methylpropanoyl) 2,2-dimethylpropanoate.
What is the SMILES notation for (2-amino-2-methylpropanoyl) 2,2-dimethylpropanoate?
The canonical SMILES for (2-amino-2-methylpropanoyl) 2,2-dimethylpropanoate is CC(C)(C)C(=O)OC(=O)C(C)(C)N.
What is the InChIKey of (2-amino-2-methylpropanoyl) 2,2-dimethylpropanoate?
The InChIKey is GMJSOJNFYWRNCU-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H17NO3/c1-8(2,3)6(11)13-7(12)9(4,5)10/h10H2,1-5H3.
What are the key properties of (2-amino-2-methylpropanoyl) 2,2-dimethylpropanoate?
(2-amino-2-methylpropanoyl) 2,2-dimethylpropanoate has a molecular weight of 187.24 g/mol, XLogP of 0.84, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (2-amino-2-methylpropanoyl) 2,2-dimethylpropanoate is sourced from PubChem (CID 163587095), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).