C12H20BrNO3 — CID 174528779
(2-bromo-2-piperidin-4-ylacetyl) 2,2-dimethylpropanoate (PubChem CID 174528779) has the molecular formula C12H20BrNO3 and a molecular weight of 306.20 g/mol. Its IUPAC name is (2-bromo-2-piperidin-4-ylacetyl) 2,2-dimethylpropanoate.
| Compound Name | (2-bromo-2-piperidin-4-ylacetyl) 2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 174528779 |
| Molecular Formula | C12H20BrNO3 |
| Molecular Weight | 306.20 g/mol |
| Exact Mass | 305.06 |
| IUPAC Name | (2-bromo-2-piperidin-4-ylacetyl) 2,2-dimethylpropanoate |
| SMILES | CC(C)(C)C(=O)OC(=O)C(Br)C1CCNCC1 |
| InChI | InChI=1S/C12H20BrNO3/c1-12(2,3)11(16)17-10(15)9(13)8-4-6-14-7-5-8/h8-9,14H,4-7H2,1-3H3 |
| InChIKey | NAVZVZSIVQUWOD-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.20 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|