C12H24N2O2 — CID 174587762
(2-amino-1-piperidin-4-ylethyl) 2,2-dimethylpropanoate (PubChem CID 174587762) has the molecular formula C12H24N2O2 and a molecular weight of 228.34 g/mol. Its IUPAC name is (2-amino-1-piperidin-4-ylethyl) 2,2-dimethylpropanoate.
| Compound Name | (2-amino-1-piperidin-4-ylethyl) 2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 174587762 |
| Molecular Formula | C12H24N2O2 |
| Molecular Weight | 228.34 g/mol |
| Exact Mass | 228.18 |
| IUPAC Name | (2-amino-1-piperidin-4-ylethyl) 2,2-dimethylpropanoate |
| SMILES | CC(C)(C)C(=O)OC(CN)C1CCNCC1 |
| InChI | InChI=1S/C12H24N2O2/c1-12(2,3)11(15)16-10(8-13)9-4-6-14-7-5-9/h9-10,14H,4-8,13H2,1-3H3 |
| InChIKey | JBOZEUFYWLUKCA-UHFFFAOYSA-N |
| XLogP | 0.90 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.34 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |