C12H26N2 — CID 95241778
(2R)-4,4-dimethyl-2-piperidin-4-ylpentan-1-amine (PubChem CID 95241778) has the molecular formula C12H26N2 and a molecular weight of 198.35 g/mol. Its IUPAC name is (2R)-4,4-dimethyl-2-piperidin-4-ylpentan-1-amine.
| Compound Name | (2R)-4,4-dimethyl-2-piperidin-4-ylpentan-1-amine |
|---|---|
| PubChem CID | 95241778 |
| Molecular Formula | C12H26N2 |
| Molecular Weight | 198.35 g/mol |
| Exact Mass | 198.21 |
| IUPAC Name | (2R)-4,4-dimethyl-2-piperidin-4-ylpentan-1-amine |
| SMILES | CC(C)(C)C[C@@H](CN)C1CCNCC1 |
| InChI | InChI=1S/C12H26N2/c1-12(2,3)8-11(9-13)10-4-6-14-7-5-10/h10-11,14H,4-9,13H2,1-3H3/t11-/m0/s1 |
| InChIKey | MBXQHKGUFWDBCZ-NSHDSACASA-N |
| XLogP | 2.00 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.35 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |