C17H34N2O — CID 124636333
N-[(4R)-2,6,6-trimethyl-4-piperidin-4-ylheptan-2-yl]acetamide (PubChem CID 124636333) has the molecular formula C17H34N2O and a molecular weight of 282.47 g/mol. Its IUPAC name is N-[(4R)-2,6,6-trimethyl-4-piperidin-4-ylheptan-2-yl]acetamide.
| Compound Name | N-[(4R)-2,6,6-trimethyl-4-piperidin-4-ylheptan-2-yl]acetamide |
|---|---|
| PubChem CID | 124636333 |
| Molecular Formula | C17H34N2O |
| Molecular Weight | 282.47 g/mol |
| Exact Mass | 282.27 |
| IUPAC Name | N-[(4R)-2,6,6-trimethyl-4-piperidin-4-ylheptan-2-yl]acetamide |
| SMILES | CC(=O)NC(C)(C)C[C@@H](CC(C)(C)C)C1CCNCC1 |
| InChI | InChI=1S/C17H34N2O/c1-13(20)19-17(5,6)12-15(11-16(2,3)4)14-7-9-18-10-8-14/h14-15,18H,7-12H2,1-6H3,(H,19,20)/t15-/m1/s1 |
| InChIKey | AGGWFQQQZGDFSD-OAHLLOKOSA-N |
| XLogP | 3.34 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.47 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |