C28H36O4 — CID 122517200
[(E)-1,2-bis(2,6-dimethylphenyl)-2-(2,2-dimethylpropanoyloxy)ethenyl] 2,2-dimethylpropanoate (PubChem CID 122517200) has the molecular formula C28H36O4 and a molecular weight of 436.59 g/mol. Its IUPAC name is [(E)-1,2-bis(2,6-dimethylphenyl)-2-(2,2-dimethylpropanoyloxy)ethenyl] 2,2-dimethylpropanoate.
| Compound Name | [(E)-1,2-bis(2,6-dimethylphenyl)-2-(2,2-dimethylpropanoyloxy)ethenyl] 2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 122517200 |
| Molecular Formula | C28H36O4 |
| Molecular Weight | 436.59 g/mol |
| Exact Mass | 436.26 |
| IUPAC Name | [(E)-1,2-bis(2,6-dimethylphenyl)-2-(2,2-dimethylpropanoyloxy)ethenyl] 2,2-dimethylpropanoate |
| SMILES | Cc1cccc(C)c1/C(OC(=O)C(C)(C)C)=C(\OC(=O)C(C)(C)C)c1c(C)cccc1C |
| InChI | InChI=1S/C28H36O4/c1-17-13-11-14-18(2)21(17)23(31-25(29)27(5,6)7)24(32-26(30)28(8,9)10)22-19(3)15-12-16-20(22)4/h11-16H,1-10H3/b24-23+ |
| InChIKey | MCMKUPCTDGYSTM-WCWDXBQESA-N |
| XLogP | 6.92 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.59 |
| LogP ≤ 5 | 6.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|