C38H40O4 — CID 134263019
[(E)-1,2-bis(2,6-dimethylphenyl)-2-(4-propylbenzoyl)oxyethenyl] 4-propylbenzoate (PubChem CID 134263019) has the molecular formula C38H40O4 and a molecular weight of 560.73 g/mol. Its IUPAC name is [(E)-1,2-bis(2,6-dimethylphenyl)-2-(4-propylbenzoyl)oxyethenyl] 4-propylbenzoate.
| Compound Name | [(E)-1,2-bis(2,6-dimethylphenyl)-2-(4-propylbenzoyl)oxyethenyl] 4-propylbenzoate |
|---|---|
| PubChem CID | 134263019 |
| Molecular Formula | C38H40O4 |
| Molecular Weight | 560.73 g/mol |
| Exact Mass | 560.29 |
| IUPAC Name | [(E)-1,2-bis(2,6-dimethylphenyl)-2-(4-propylbenzoyl)oxyethenyl] 4-propylbenzoate |
| SMILES | CCCc1ccc(C(=O)O/C(=C(/OC(=O)c2ccc(CCC)cc2)c2c(C)cccc2C)c2c(C)cccc2C)cc1 |
| InChI | InChI=1S/C38H40O4/c1-7-11-29-17-21-31(22-18-29)37(39)41-35(33-25(3)13-9-14-26(33)4)36(34-27(5)15-10-16-28(34)6)42-38(40)32-23-19-30(12-8-2)20-24-32/h9-10,13-24H,7-8,11-12H2,1-6H3/b36-35+ |
| InChIKey | AYEAYWCPWDKQQT-ULDVOPSXSA-N |
| XLogP | 9.37 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.73 |
| LogP ≤ 5 | 9.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|