C44H52O4 — CID 138606475
[2-(4-butylbenzoyl)oxy-1,2-bis(4-tert-butylphenyl)ethenyl] 4-butylbenzoate (PubChem CID 138606475) has the molecular formula C44H52O4 and a molecular weight of 644.90 g/mol. Its IUPAC name is [2-(4-butylbenzoyl)oxy-1,2-bis(4-tert-butylphenyl)ethenyl] 4-butylbenzoate.
| Compound Name | [2-(4-butylbenzoyl)oxy-1,2-bis(4-tert-butylphenyl)ethenyl] 4-butylbenzoate |
|---|---|
| PubChem CID | 138606475 |
| Molecular Formula | C44H52O4 |
| Molecular Weight | 644.90 g/mol |
| Exact Mass | 644.39 |
| IUPAC Name | [2-(4-butylbenzoyl)oxy-1,2-bis(4-tert-butylphenyl)ethenyl] 4-butylbenzoate |
| SMILES | CCCCc1ccc(C(=O)OC(=C(OC(=O)c2ccc(CCCC)cc2)c2ccc(C(C)(C)C)cc2)c2ccc(C(C)(C)C)cc2)cc1 |
| InChI | InChI=1S/C44H52O4/c1-9-11-13-31-15-19-35(20-16-31)41(45)47-39(33-23-27-37(28-24-33)43(3,4)5)40(34-25-29-38(30-26-34)44(6,7)8)48-42(46)36-21-17-32(18-22-36)14-12-10-2/h15-30H,9-14H2,1-8H3 |
| InChIKey | HWQDMDNFAHEBAC-UHFFFAOYSA-N |
| XLogP | 11.51 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 644.90 |
| LogP ≤ 5 | 11.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|