C20H22O2 — CID 123526620
4-[2-(2-but-1-en-2-yl-3-methylphenyl)ethyl]benzoic acid (PubChem CID 123526620) has the molecular formula C20H22O2 and a molecular weight of 294.39 g/mol. Its IUPAC name is 4-[2-(2-but-1-en-2-yl-3-methylphenyl)ethyl]benzoic acid.
| Compound Name | 4-[2-(2-but-1-en-2-yl-3-methylphenyl)ethyl]benzoic acid |
|---|---|
| PubChem CID | 123526620 |
| Molecular Formula | C20H22O2 |
| Molecular Weight | 294.39 g/mol |
| Exact Mass | 294.16 |
| IUPAC Name | 4-[2-(2-but-1-en-2-yl-3-methylphenyl)ethyl]benzoic acid |
| SMILES | C=C(CC)c1c(C)cccc1CCc1ccc(C(=O)O)cc1 |
| InChI | InChI=1S/C20H22O2/c1-4-14(2)19-15(3)6-5-7-17(19)11-8-16-9-12-18(13-10-16)20(21)22/h5-7,9-10,12-13H,2,4,8,11H2,1,3H3,(H,21,22) |
| InChIKey | FITNBDHDSCRQQZ-UHFFFAOYSA-N |
| XLogP | 4.90 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.39 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |