C20H27NO3 — CID 91087628
ethane;ethyl 2-oxo-7b-[(E)-pent-1-enyl]-1,3-dihydrocyclopropa[c]quinoline-1a-carboxylate (PubChem CID 91087628) has the molecular formula C20H27NO3 and a molecular weight of 329.44 g/mol. Its IUPAC name is ethane;ethyl 2-oxo-7b-[(E)-pent-1-enyl]-1,3-dihydrocyclopropa[c]quinoline-1a-carboxylate.
| Compound Name | ethane;ethyl 2-oxo-7b-[(E)-pent-1-enyl]-1,3-dihydrocyclopropa[c]quinoline-1a-carboxylate |
|---|---|
| PubChem CID | 91087628 |
| Molecular Formula | C20H27NO3 |
| Molecular Weight | 329.44 g/mol |
| Exact Mass | 329.20 |
| IUPAC Name | ethane;ethyl 2-oxo-7b-[(E)-pent-1-enyl]-1,3-dihydrocyclopropa[c]quinoline-1a-carboxylate |
| SMILES | CC.CCC/C=C/C12CC1(C(=O)OCC)C(=O)Nc1ccccc12 |
| InChI | InChI=1S/C18H21NO3.C2H6/c1-3-5-8-11-17-12-18(17,16(21)22-4-2)15(20)19-14-10-7-6-9-13(14)17;1-2/h6-11H,3-5,12H2,1-2H3,(H,19,20);1-2H3/b11-8+; |
| InChIKey | JUCWFQOOCKDNNV-YGCVIUNWSA-N |
| XLogP | 4.21 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.44 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|