About ethane;3-(2-ethoxyethyl)-3-methyl-1H-indol-2-one;ethyl propanoate
ethane;3-(2-ethoxyethyl)-3-methyl-1H-indol-2-one;ethyl propanoate (PubChem CID 143412746) has the molecular formula C20H33NO4
and a molecular weight of 351.49 g/mol. Its IUPAC name is ethane;3-(2-ethoxyethyl)-3-methyl-1H-indol-2-one;ethyl propanoate.
Molecular Properties
| Compound Name | ethane;3-(2-ethoxyethyl)-3-methyl-1H-indol-2-one;ethyl propanoate |
| PubChem CID | 143412746 |
| Molecular Formula | C20H33NO4 |
| Molecular Weight | 351.49 g/mol |
| Exact Mass | 351.24 |
| IUPAC Name | ethane;3-(2-ethoxyethyl)-3-methyl-1H-indol-2-one;ethyl propanoate |
| SMILES | CC.CCOC(=O)CC.CCOCCC1(C)C(=O)Nc2ccccc21 |
| InChI | InChI=1S/C13H17NO2.C5H10O2.C2H6/c1-3-16-9-8-13(2)10-6-4-5-7-11(10)14-12(13)15;1-3-5(6)7-4-2;1-2/h4-7H,3,8-9H2,1-2H3,(H,14,15);3-4H2,1-2H3;1-2H3 |
| InChIKey | JJJNDRBQPRONLH-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 351.49 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze ethane;3-(2-ethoxyethyl)-3-methyl-1H-indol-2-one;ethyl propanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;3-(2-ethoxyethyl)-3-methyl-1H-indol-2-one;ethyl propanoate?
The IUPAC name of ethane;3-(2-ethoxyethyl)-3-methyl-1H-indol-2-one;ethyl propanoate (CID 143412746) is ethane;3-(2-ethoxyethyl)-3-methyl-1H-indol-2-one;ethyl propanoate.
What is the SMILES notation for ethane;3-(2-ethoxyethyl)-3-methyl-1H-indol-2-one;ethyl propanoate?
The canonical SMILES for ethane;3-(2-ethoxyethyl)-3-methyl-1H-indol-2-one;ethyl propanoate is CC.CCOC(=O)CC.CCOCCC1(C)C(=O)Nc2ccccc21.
What is the InChIKey of ethane;3-(2-ethoxyethyl)-3-methyl-1H-indol-2-one;ethyl propanoate?
The InChIKey is JJJNDRBQPRONLH-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H17NO2.C5H10O2.C2H6/c1-3-16-9-8-13(2)10-6-4-5-7-11(10)14-12(13)15;1-3-5(6)7-4-2;1-2/h4-7H,3,8-9H2,1-2H3,(H,14,15);3-4H2,1-2H3;1-2H3.
What are the key properties of ethane;3-(2-ethoxyethyl)-3-methyl-1H-indol-2-one;ethyl propanoate?
ethane;3-(2-ethoxyethyl)-3-methyl-1H-indol-2-one;ethyl propanoate has a molecular weight of 351.49 g/mol, XLogP of 4.31, 6 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;3-(2-ethoxyethyl)-3-methyl-1H-indol-2-one;ethyl propanoate is sourced from PubChem (CID 143412746), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).