C11H12O — CID 11789506
1,2,7,7a-tetrahydrocyclopropa[b]naphthalen-1a-ol (PubChem CID 11789506) has the molecular formula C11H12O and a molecular weight of 160.22 g/mol. Its IUPAC name is 1,2,7,7a-tetrahydrocyclopropa[b]naphthalen-1a-ol.
| Compound Name | 1,2,7,7a-tetrahydrocyclopropa[b]naphthalen-1a-ol |
|---|---|
| PubChem CID | 11789506 |
| Molecular Formula | C11H12O |
| Molecular Weight | 160.22 g/mol |
| Exact Mass | 160.09 |
| IUPAC Name | 1,2,7,7a-tetrahydrocyclopropa[b]naphthalen-1a-ol |
| SMILES | OC12Cc3ccccc3CC1C2 |
| InChI | InChI=1S/C11H12O/c12-11-6-9-4-2-1-3-8(9)5-10(11)7-11/h1-4,10,12H,5-7H2 |
| InChIKey | BMMIWVJQOFQKHQ-UHFFFAOYSA-N |
| XLogP | 1.54 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 160.22 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |