C14H18O2 — CID 107135477
2-(oxan-3-yl)-1,3-dihydroinden-2-ol (PubChem CID 107135477) has the molecular formula C14H18O2 and a molecular weight of 218.30 g/mol. Its IUPAC name is 2-(oxan-3-yl)-1,3-dihydroinden-2-ol.
| Compound Name | 2-(oxan-3-yl)-1,3-dihydroinden-2-ol |
|---|---|
| PubChem CID | 107135477 |
| Molecular Formula | C14H18O2 |
| Molecular Weight | 218.30 g/mol |
| Exact Mass | 218.13 |
| IUPAC Name | 2-(oxan-3-yl)-1,3-dihydroinden-2-ol |
| SMILES | OC1(C2CCCOC2)Cc2ccccc2C1 |
| InChI | InChI=1S/C14H18O2/c15-14(13-6-3-7-16-10-13)8-11-4-1-2-5-12(11)9-14/h1-2,4-5,13,15H,3,6-10H2 |
| InChIKey | ZAWITHGTSAEQBO-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.30 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |