C9H16O4 — CID 130559698
6-(oxolan-3-yl)-1,4-dioxepan-6-ol (PubChem CID 130559698) has the molecular formula C9H16O4 and a molecular weight of 188.22 g/mol. Its IUPAC name is 6-(oxolan-3-yl)-1,4-dioxepan-6-ol.
| Compound Name | 6-(oxolan-3-yl)-1,4-dioxepan-6-ol |
|---|---|
| PubChem CID | 130559698 |
| Molecular Formula | C9H16O4 |
| Molecular Weight | 188.22 g/mol |
| Exact Mass | 188.10 |
| IUPAC Name | 6-(oxolan-3-yl)-1,4-dioxepan-6-ol |
| SMILES | OC1(C2CCOC2)COCCOC1 |
| InChI | InChI=1S/C9H16O4/c10-9(8-1-2-11-5-8)6-12-3-4-13-7-9/h8,10H,1-7H2 |
| InChIKey | INNAWONDHHZVJR-UHFFFAOYSA-N |
| XLogP | -0.20 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 188.22 |
| LogP ≤ 5 | -0.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |