About 7-oxatricyclo[6.4.0.03,5]dodeca-1(12),8,10-trien-5-ol
7-oxatricyclo[6.4.0.03,5]dodeca-1(12),8,10-trien-5-ol (PubChem CID 85416076) has the molecular formula C11H12O2
and a molecular weight of 176.22 g/mol. Its IUPAC name is 7-oxatricyclo[6.4.0.03,5]dodeca-1(12),8,10-trien-5-ol.
Analyze 7-oxatricyclo[6.4.0.03,5]dodeca-1(12),8,10-trien-5-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-oxatricyclo[6.4.0.03,5]dodeca-1(12),8,10-trien-5-ol?
The IUPAC name of 7-oxatricyclo[6.4.0.03,5]dodeca-1(12),8,10-trien-5-ol (CID 85416076) is 7-oxatricyclo[6.4.0.03,5]dodeca-1(12),8,10-trien-5-ol.
What is the SMILES notation for 7-oxatricyclo[6.4.0.03,5]dodeca-1(12),8,10-trien-5-ol?
The canonical SMILES for 7-oxatricyclo[6.4.0.03,5]dodeca-1(12),8,10-trien-5-ol is OC12COc3ccccc3CC1C2.
What is the InChIKey of 7-oxatricyclo[6.4.0.03,5]dodeca-1(12),8,10-trien-5-ol?
The InChIKey is VYCGCRPWKXOJMO-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H12O2/c12-11-6-9(11)5-8-3-1-2-4-10(8)13-7-11/h1-4,9,12H,5-7H2.
What are the key properties of 7-oxatricyclo[6.4.0.03,5]dodeca-1(12),8,10-trien-5-ol?
7-oxatricyclo[6.4.0.03,5]dodeca-1(12),8,10-trien-5-ol has a molecular weight of 176.22 g/mol, XLogP of 1.37, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 7-oxatricyclo[6.4.0.03,5]dodeca-1(12),8,10-trien-5-ol is sourced from PubChem (CID 85416076), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).