C10H12O2 — CID 163222084
(3S)-3-methyl-2,4-dihydrochromen-3-ol (PubChem CID 163222084) has the molecular formula C10H12O2 and a molecular weight of 164.20 g/mol. Its IUPAC name is (3S)-3-methyl-2,4-dihydrochromen-3-ol.
| Compound Name | (3S)-3-methyl-2,4-dihydrochromen-3-ol |
|---|---|
| PubChem CID | 163222084 |
| Molecular Formula | C10H12O2 |
| Molecular Weight | 164.20 g/mol |
| Exact Mass | 164.08 |
| IUPAC Name | (3S)-3-methyl-2,4-dihydrochromen-3-ol |
| SMILES | C[C@@]1(O)COc2ccccc2C1 |
| InChI | InChI=1S/C10H12O2/c1-10(11)6-8-4-2-3-5-9(8)12-7-10/h2-5,11H,6-7H2,1H3/t10-/m0/s1 |
| InChIKey | QPBJXWYXPAYROT-JTQLQIEISA-N |
| XLogP | 1.37 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 164.20 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |