C13H14O2 — CID 130632278
3-cyclopropyl-2,4-dihydrochromene-3-carbaldehyde (PubChem CID 130632278) has the molecular formula C13H14O2 and a molecular weight of 202.25 g/mol. Its IUPAC name is 3-cyclopropyl-2,4-dihydrochromene-3-carbaldehyde.
| Compound Name | 3-cyclopropyl-2,4-dihydrochromene-3-carbaldehyde |
|---|---|
| PubChem CID | 130632278 |
| Molecular Formula | C13H14O2 |
| Molecular Weight | 202.25 g/mol |
| Exact Mass | 202.10 |
| IUPAC Name | 3-cyclopropyl-2,4-dihydrochromene-3-carbaldehyde |
| SMILES | O=CC1(C2CC2)COc2ccccc2C1 |
| InChI | InChI=1S/C13H14O2/c14-8-13(11-5-6-11)7-10-3-1-2-4-12(10)15-9-13/h1-4,8,11H,5-7,9H2 |
| InChIKey | GZVZGLHNDOFOLD-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.25 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|