C12H14O3 — CID 130704898
3-(2-hydroxyethyl)-2,4-dihydrochromene-3-carbaldehyde (PubChem CID 130704898) has the molecular formula C12H14O3 and a molecular weight of 206.24 g/mol. Its IUPAC name is 3-(2-hydroxyethyl)-2,4-dihydrochromene-3-carbaldehyde.
| Compound Name | 3-(2-hydroxyethyl)-2,4-dihydrochromene-3-carbaldehyde |
|---|---|
| PubChem CID | 130704898 |
| Molecular Formula | C12H14O3 |
| Molecular Weight | 206.24 g/mol |
| Exact Mass | 206.09 |
| IUPAC Name | 3-(2-hydroxyethyl)-2,4-dihydrochromene-3-carbaldehyde |
| SMILES | O=CC1(CCO)COc2ccccc2C1 |
| InChI | InChI=1S/C12H14O3/c13-6-5-12(8-14)7-10-3-1-2-4-11(10)15-9-12/h1-4,8,13H,5-7,9H2 |
| InChIKey | FVOYQSMEIJHFNM-UHFFFAOYSA-N |
| XLogP | 1.19 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.24 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|