C10H8BrNO — CID 131107497
3-bromo-2,4-dihydrochromene-3-carbonitrile (PubChem CID 131107497) has the molecular formula C10H8BrNO and a molecular weight of 238.08 g/mol. Its IUPAC name is 3-bromo-2,4-dihydrochromene-3-carbonitrile.
| Compound Name | 3-bromo-2,4-dihydrochromene-3-carbonitrile |
|---|---|
| PubChem CID | 131107497 |
| Molecular Formula | C10H8BrNO |
| Molecular Weight | 238.08 g/mol |
| Exact Mass | 236.98 |
| IUPAC Name | 3-bromo-2,4-dihydrochromene-3-carbonitrile |
| SMILES | N#CC1(Br)COc2ccccc2C1 |
| InChI | InChI=1S/C10H8BrNO/c11-10(6-12)5-8-3-1-2-4-9(8)13-7-10/h1-4H,5,7H2 |
| InChIKey | QZBNKJJEFAFXOO-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 33.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.08 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|