C12H12O2 — CID 130605047
3-prop-1-ynyl-2,4-dihydrochromen-3-ol (PubChem CID 130605047) has the molecular formula C12H12O2 and a molecular weight of 188.23 g/mol. Its IUPAC name is 3-prop-1-ynyl-2,4-dihydrochromen-3-ol.
| Compound Name | 3-prop-1-ynyl-2,4-dihydrochromen-3-ol |
|---|---|
| PubChem CID | 130605047 |
| Molecular Formula | C12H12O2 |
| Molecular Weight | 188.23 g/mol |
| Exact Mass | 188.08 |
| IUPAC Name | 3-prop-1-ynyl-2,4-dihydrochromen-3-ol |
| SMILES | CC#CC1(O)COc2ccccc2C1 |
| InChI | InChI=1S/C12H12O2/c1-2-7-12(13)8-10-5-3-4-6-11(10)14-9-12/h3-6,13H,8-9H2,1H3 |
| InChIKey | YTDHAVBRJGFSLI-UHFFFAOYSA-N |
| XLogP | 1.38 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 188.23 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|