C11H12O3 — CID 130631253
3-methoxy-2,4-dihydrochromene-3-carbaldehyde (PubChem CID 130631253) has the molecular formula C11H12O3 and a molecular weight of 192.21 g/mol. Its IUPAC name is 3-methoxy-2,4-dihydrochromene-3-carbaldehyde.
| Compound Name | 3-methoxy-2,4-dihydrochromene-3-carbaldehyde |
|---|---|
| PubChem CID | 130631253 |
| Molecular Formula | C11H12O3 |
| Molecular Weight | 192.21 g/mol |
| Exact Mass | 192.08 |
| IUPAC Name | 3-methoxy-2,4-dihydrochromene-3-carbaldehyde |
| SMILES | COC1(C=O)COc2ccccc2C1 |
| InChI | InChI=1S/C11H12O3/c1-13-11(7-12)6-9-4-2-3-5-10(9)14-8-11/h2-5,7H,6,8H2,1H3 |
| InChIKey | JDRZBJHRVQIRKX-UHFFFAOYSA-N |
| XLogP | 1.21 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.21 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|