C11H14O2 — CID 132962049
[(3R)-3-methyl-2,4-dihydrochromen-3-yl]methanol (PubChem CID 132962049) has the molecular formula C11H14O2 and a molecular weight of 178.23 g/mol. Its IUPAC name is [(3R)-3-methyl-2,4-dihydrochromen-3-yl]methanol.
| Compound Name | [(3R)-3-methyl-2,4-dihydrochromen-3-yl]methanol |
|---|---|
| PubChem CID | 132962049 |
| Molecular Formula | C11H14O2 |
| Molecular Weight | 178.23 g/mol |
| Exact Mass | 178.10 |
| IUPAC Name | [(3R)-3-methyl-2,4-dihydrochromen-3-yl]methanol |
| SMILES | C[C@@]1(CO)COc2ccccc2C1 |
| InChI | InChI=1S/C11H14O2/c1-11(7-12)6-9-4-2-3-5-10(9)13-8-11/h2-5,12H,6-8H2,1H3/t11-/m1/s1 |
| InChIKey | HOEYCPFZFYJQBE-LLVKDONJSA-N |
| XLogP | 1.62 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 178.23 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |