C15H19NOS — CID 113474696
3-(3-ethylsulfanylpropyl)-2,4-dihydrochromene-3-carbonitrile (PubChem CID 113474696) has the molecular formula C15H19NOS and a molecular weight of 261.39 g/mol. Its IUPAC name is 3-(3-ethylsulfanylpropyl)-2,4-dihydrochromene-3-carbonitrile.
| Compound Name | 3-(3-ethylsulfanylpropyl)-2,4-dihydrochromene-3-carbonitrile |
|---|---|
| PubChem CID | 113474696 |
| Molecular Formula | C15H19NOS |
| Molecular Weight | 261.39 g/mol |
| Exact Mass | 261.12 |
| IUPAC Name | 3-(3-ethylsulfanylpropyl)-2,4-dihydrochromene-3-carbonitrile |
| SMILES | CCSCCCC1(C#N)COc2ccccc2C1 |
| InChI | InChI=1S/C15H19NOS/c1-2-18-9-5-8-15(11-16)10-13-6-3-4-7-14(13)17-12-15/h3-4,6-7H,2,5,8-10,12H2,1H3 |
| InChIKey | QCVWPEFCOWKQQL-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 33.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.39 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|