C12H13ClO — CID 130840671
2'-(chloromethyl)spiro[2,4-dihydrochromene-3,1'-cyclopropane] (PubChem CID 130840671) has the molecular formula C12H13ClO and a molecular weight of 208.69 g/mol. Its IUPAC name is 2'-(chloromethyl)spiro[2,4-dihydrochromene-3,1'-cyclopropane].
| Compound Name | 2'-(chloromethyl)spiro[2,4-dihydrochromene-3,1'-cyclopropane] |
|---|---|
| PubChem CID | 130840671 |
| Molecular Formula | C12H13ClO |
| Molecular Weight | 208.69 g/mol |
| Exact Mass | 208.07 |
| IUPAC Name | 2'-(chloromethyl)spiro[2,4-dihydrochromene-3,1'-cyclopropane] |
| SMILES | ClCC1CC12COc1ccccc1C2 |
| InChI | InChI=1S/C12H13ClO/c13-7-10-6-12(10)5-9-3-1-2-4-11(9)14-8-12/h1-4,10H,5-8H2 |
| InChIKey | RGGGNOWBGAJNSF-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.69 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|