C11H12N2O — CID 19919894
spiro[1,4-dihydroimidazole-5,3'-2,4-dihydrochromene] (PubChem CID 19919894) has the molecular formula C11H12N2O and a molecular weight of 188.23 g/mol. Its IUPAC name is spiro[1,4-dihydroimidazole-5,3'-2,4-dihydrochromene].
| Compound Name | spiro[1,4-dihydroimidazole-5,3'-2,4-dihydrochromene] |
|---|---|
| PubChem CID | 19919894 |
| Molecular Formula | C11H12N2O |
| Molecular Weight | 188.23 g/mol |
| Exact Mass | 188.09 |
| IUPAC Name | spiro[1,4-dihydroimidazole-5,3'-2,4-dihydrochromene] |
| SMILES | C1=NCC2(COc3ccccc3C2)N1 |
| InChI | InChI=1S/C11H12N2O/c1-2-4-10-9(3-1)5-11(7-14-10)6-12-8-13-11/h1-4,8H,5-7H2,(H,12,13) |
| InChIKey | QACLOABNNXKSBA-UHFFFAOYSA-N |
| XLogP | 0.99 |
| TPSA | 33.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 188.23 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |