C27H24O — CID 125035583
phenyl-[(3R,4R,5R,7S,8S,9S,10R,12R,13R,14S,18R,19S)-1-undecacyclo[9.9.0.02,9.03,7.04,20.05,18.06,16.08,15.010,14.012,19.013,17]icosanyl]methanone (PubChem CID 125035583) has the molecular formula C27H24O and a molecular weight of 364.49 g/mol. Its IUPAC name is phenyl-[(3R,4R,5R,7S,8S,9S,10R,12R,13R,14S,18R,19S)-1-undecacyclo[9.9.0.02,9.03,7.04,20.05,18.06,16.08,15.010,14.012,19.013,17]icosanyl]methanone.
| Compound Name | phenyl-[(3R,4R,5R,7S,8S,9S,10R,12R,13R,14S,18R,19S)-1-undecacyclo[9.9.0.02,9.03,7.04,20.05,18.06,16.08,15.010,14.012,19.013,17]icosanyl]methanone |
|---|---|
| PubChem CID | 125035583 |
| Molecular Formula | C27H24O |
| Molecular Weight | 364.49 g/mol |
| Exact Mass | 364.18 |
| IUPAC Name | phenyl-[(3R,4R,5R,7S,8S,9S,10R,12R,13R,14S,18R,19S)-1-undecacyclo[9.9.0.02,9.03,7.04,20.05,18.06,16.08,15.010,14.012,19.013,17]icosanyl]methanone |
| SMILES | O=C(c1ccccc1)C12C3[C@@H]4[C@@H]5C6C7C8[C@@H]9[C@@H]6[C@@H]4C1[C@H]9[C@@H]1C2[C@H]2[C@@H](C7[C@@H]5[C@@H]32)[C@H]81 |
| InChI | InChI=1S/C27H24O/c28-26(6-4-2-1-3-5-6)27-23-17-11-8-7-9-13(11)19(23)21-15(9)16-10(7)14-12(8)18(17)24(27)20(14)22(16)25(21)27/h1-5,7-25H/t7?,8?,9?,10?,11-,12-,13-,14+,15+,16+,17-,18+,19+,20+,21+,22-,23?,24?,25?,27?/m0/s1 |
| InChIKey | QJYIOJPJBXQJIW-KETLHVQPSA-N |
| XLogP | 3.71 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.49 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |