C19H23NO2 — CID 89201066
(E)-N-(1,7-dimethyl-7-bicyclo[2.2.1]heptanyl)-2-oxo-4-phenylbut-3-enamide (PubChem CID 89201066) has the molecular formula C19H23NO2 and a molecular weight of 297.40 g/mol. Its IUPAC name is (E)-N-(1,7-dimethyl-7-bicyclo[2.2.1]heptanyl)-2-oxo-4-phenylbut-3-enamide.
| Compound Name | (E)-N-(1,7-dimethyl-7-bicyclo[2.2.1]heptanyl)-2-oxo-4-phenylbut-3-enamide |
|---|---|
| PubChem CID | 89201066 |
| Molecular Formula | C19H23NO2 |
| Molecular Weight | 297.40 g/mol |
| Exact Mass | 297.17 |
| IUPAC Name | (E)-N-(1,7-dimethyl-7-bicyclo[2.2.1]heptanyl)-2-oxo-4-phenylbut-3-enamide |
| SMILES | CC12CCC(CC1)C2(C)NC(=O)C(=O)/C=C/c1ccccc1 |
| InChI | InChI=1S/C19H23NO2/c1-18-12-10-15(11-13-18)19(18,2)20-17(22)16(21)9-8-14-6-4-3-5-7-14/h3-9,15H,10-13H2,1-2H3,(H,20,22)/b9-8+ |
| InChIKey | ITYADVDEUFJCFO-CMDGGOBGSA-N |
| XLogP | 3.35 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.40 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|