C26H37N3O — CID 71189181
N-[(7S)-1,7-dimethyl-7-bicyclo[2.2.1]heptanyl]-4-phenyl-5-(2,2,3,3-tetramethylcyclopropyl)-3,4-dihydropyrazole-2-carboxamide (PubChem CID 71189181) has the molecular formula C26H37N3O and a molecular weight of 407.60 g/mol. Its IUPAC name is N-[(7S)-1,7-dimethyl-7-bicyclo[2.2.1]heptanyl]-4-phenyl-5-(2,2,3,3-tetramethylcyclopropyl)-3,4-dihydropyrazole-2-carboxamide.
| Compound Name | N-[(7S)-1,7-dimethyl-7-bicyclo[2.2.1]heptanyl]-4-phenyl-5-(2,2,3,3-tetramethylcyclopropyl)-3,4-dihydropyrazole-2-carboxamide |
|---|---|
| PubChem CID | 71189181 |
| Molecular Formula | C26H37N3O |
| Molecular Weight | 407.60 g/mol |
| Exact Mass | 407.29 |
| IUPAC Name | N-[(7S)-1,7-dimethyl-7-bicyclo[2.2.1]heptanyl]-4-phenyl-5-(2,2,3,3-tetramethylcyclopropyl)-3,4-dihydropyrazole-2-carboxamide |
| SMILES | CC1(C)C(C2=NN(C(=O)N[C@@]3(C)C4CCC3(C)CC4)CC2c2ccccc2)C1(C)C |
| InChI | InChI=1S/C26H37N3O/c1-23(2)21(24(23,3)4)20-19(17-10-8-7-9-11-17)16-29(28-20)22(30)27-26(6)18-12-14-25(26,5)15-13-18/h7-11,18-19,21H,12-16H2,1-6H3,(H,27,30)/t18?,19?,25?,26-/m0/s1 |
| InChIKey | VIVPMWSKMNTCOC-PTYYLFHFSA-N |
| XLogP | 5.80 |
| TPSA | 44.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.60 |
| LogP ≤ 5 | 5.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |