C23H34N4O — CID 58899503
5-butyl-4-pyridin-3-yl-N-[(1R,2S,4S)-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl]-3,4-dihydropyrazole-2-carboxamide (PubChem CID 58899503) has the molecular formula C23H34N4O and a molecular weight of 382.55 g/mol. Its IUPAC name is 5-butyl-4-pyridin-3-yl-N-[(1R,2S,4S)-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl]-3,4-dihydropyrazole-2-carboxamide.
| Compound Name | 5-butyl-4-pyridin-3-yl-N-[(1R,2S,4S)-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl]-3,4-dihydropyrazole-2-carboxamide |
|---|---|
| PubChem CID | 58899503 |
| Molecular Formula | C23H34N4O |
| Molecular Weight | 382.55 g/mol |
| Exact Mass | 382.27 |
| IUPAC Name | 5-butyl-4-pyridin-3-yl-N-[(1R,2S,4S)-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl]-3,4-dihydropyrazole-2-carboxamide |
| SMILES | CCCCC1=NN(C(=O)N[C@H]2C[C@@H]3CC[C@]2(C)C3(C)C)CC1c1cccnc1 |
| InChI | InChI=1S/C23H34N4O/c1-5-6-9-19-18(16-8-7-12-24-14-16)15-27(26-19)21(28)25-20-13-17-10-11-23(20,4)22(17,2)3/h7-8,12,14,17-18,20H,5-6,9-11,13,15H2,1-4H3,(H,25,28)/t17-,18?,20-,23-/m0/s1 |
| InChIKey | CRGUWYZVJCFACH-XLIBJESPSA-N |
| XLogP | 4.95 |
| TPSA | 57.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.55 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |