C25H34F3N3O — CID 59864963
5,5-dimethyl-4-phenyl-3-(3,3,3-trifluoropropyl)-N-[(1R,2S,4S)-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl]-4H-pyrazole-1-carboxamide (PubChem CID 59864963) has the molecular formula C25H34F3N3O and a molecular weight of 449.56 g/mol. Its IUPAC name is 5,5-dimethyl-4-phenyl-3-(3,3,3-trifluoropropyl)-N-[(1R,2S,4S)-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl]-4H-pyrazole-1-carboxamide.
| Compound Name | 5,5-dimethyl-4-phenyl-3-(3,3,3-trifluoropropyl)-N-[(1R,2S,4S)-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl]-4H-pyrazole-1-carboxamide |
|---|---|
| PubChem CID | 59864963 |
| Molecular Formula | C25H34F3N3O |
| Molecular Weight | 449.56 g/mol |
| Exact Mass | 449.27 |
| IUPAC Name | 5,5-dimethyl-4-phenyl-3-(3,3,3-trifluoropropyl)-N-[(1R,2S,4S)-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl]-4H-pyrazole-1-carboxamide |
| SMILES | CC1(C)C(c2ccccc2)C(CCC(F)(F)F)=NN1C(=O)N[C@H]1C[C@@H]2CC[C@]1(C)C2(C)C |
| InChI | InChI=1S/C25H34F3N3O/c1-22(2)17-11-13-24(22,5)19(15-17)29-21(32)31-23(3,4)20(16-9-7-6-8-10-16)18(30-31)12-14-25(26,27)28/h6-10,17,19-20H,11-15H2,1-5H3,(H,29,32)/t17-,19-,20?,24-/m0/s1 |
| InChIKey | CBEVKUOBYXPCQF-BEZDMBPWSA-N |
| XLogP | 6.49 |
| TPSA | 44.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.56 |
| LogP ≤ 5 | 6.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |