C24H32F3N3O — CID 67068924
4-phenyl-5-(4,4,4-trifluorobutyl)-N-(1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl)-3,4-dihydropyrazole-2-carboxamide (PubChem CID 67068924) has the molecular formula C24H32F3N3O and a molecular weight of 435.53 g/mol. Its IUPAC name is 4-phenyl-5-(4,4,4-trifluorobutyl)-N-(1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl)-3,4-dihydropyrazole-2-carboxamide.
| Compound Name | 4-phenyl-5-(4,4,4-trifluorobutyl)-N-(1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl)-3,4-dihydropyrazole-2-carboxamide |
|---|---|
| PubChem CID | 67068924 |
| Molecular Formula | C24H32F3N3O |
| Molecular Weight | 435.53 g/mol |
| Exact Mass | 435.25 |
| IUPAC Name | 4-phenyl-5-(4,4,4-trifluorobutyl)-N-(1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl)-3,4-dihydropyrazole-2-carboxamide |
| SMILES | CC1(C)C2CCC1(C)C(NC(=O)N1CC(c3ccccc3)C(CCCC(F)(F)F)=N1)C2 |
| InChI | InChI=1S/C24H32F3N3O/c1-22(2)17-11-13-23(22,3)20(14-17)28-21(31)30-15-18(16-8-5-4-6-9-16)19(29-30)10-7-12-24(25,26)27/h4-6,8-9,17-18,20H,7,10-15H2,1-3H3,(H,28,31) |
| InChIKey | IGKLKPSBNMTZGP-UHFFFAOYSA-N |
| XLogP | 6.10 |
| TPSA | 44.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.53 |
| LogP ≤ 5 | 6.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |