C50H74N6O2 — CID 157413579
5-pentyl-4-phenyl-N-[(1R,2S,4R)-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl]-3,4-dihydropyrazole-2-carboxamide (PubChem CID 157413579) has the molecular formula C50H74N6O2 and a molecular weight of 791.18 g/mol. Its IUPAC name is 5-pentyl-4-phenyl-N-[(1R,2S,4R)-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl]-3,4-dihydropyrazole-2-carboxamide.
| Compound Name | 5-pentyl-4-phenyl-N-[(1R,2S,4R)-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl]-3,4-dihydropyrazole-2-carboxamide |
|---|---|
| PubChem CID | 157413579 |
| Molecular Formula | C50H74N6O2 |
| Molecular Weight | 791.18 g/mol |
| Exact Mass | 790.59 |
| IUPAC Name | 5-pentyl-4-phenyl-N-[(1R,2S,4R)-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl]-3,4-dihydropyrazole-2-carboxamide |
| SMILES | CCCCCC1=NN(C(=O)N[C@H]2C[C@H]3CC[C@]2(C)C3(C)C)CC1c1ccccc1.CCCCCC1=NN(C(=O)N[C@H]2C[C@H]3CC[C@]2(C)C3(C)C)CC1c1ccccc1 |
| InChI | InChI=1S/2C25H37N3O/c2*1-5-6-8-13-21-20(18-11-9-7-10-12-18)17-28(27-21)23(29)26-22-16-19-14-15-25(22,4)24(19,2)3/h2*7,9-12,19-20,22H,5-6,8,13-17H2,1-4H3,(H,26,29)/t2*19-,20?,22+,25+/m11/s1 |
| InChIKey | BOOQKPOHAJBSCI-GULNUSLHSA-N |
| XLogP | 11.89 |
| TPSA | 89.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 58 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 791.18 |
| LogP ≤ 5 | 11.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|