C27H31N3O — CID 58899482
N-(1-naphthalen-1-ylethyl)-5-pentyl-4-phenyl-3,4-dihydropyrazole-2-carboxamide (PubChem CID 58899482) has the molecular formula C27H31N3O and a molecular weight of 413.57 g/mol. Its IUPAC name is N-(1-naphthalen-1-ylethyl)-5-pentyl-4-phenyl-3,4-dihydropyrazole-2-carboxamide.
| Compound Name | N-(1-naphthalen-1-ylethyl)-5-pentyl-4-phenyl-3,4-dihydropyrazole-2-carboxamide |
|---|---|
| PubChem CID | 58899482 |
| Molecular Formula | C27H31N3O |
| Molecular Weight | 413.57 g/mol |
| Exact Mass | 413.25 |
| IUPAC Name | N-(1-naphthalen-1-ylethyl)-5-pentyl-4-phenyl-3,4-dihydropyrazole-2-carboxamide |
| SMILES | CCCCCC1=NN(C(=O)NC(C)c2cccc3ccccc23)CC1c1ccccc1 |
| InChI | InChI=1S/C27H31N3O/c1-3-4-6-18-26-25(22-12-7-5-8-13-22)19-30(29-26)27(31)28-20(2)23-17-11-15-21-14-9-10-16-24(21)23/h5,7-17,20,25H,3-4,6,18-19H2,1-2H3,(H,28,31) |
| InChIKey | HXNRPJTXDVYVID-UHFFFAOYSA-N |
| XLogP | 6.65 |
| TPSA | 44.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.57 |
| LogP ≤ 5 | 6.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|