C23H29N3O — CID 24863230
5-pentyl-4-phenyl-N-(1-phenylethyl)-3,4-dihydropyrazole-2-carboxamide (PubChem CID 24863230) has the molecular formula C23H29N3O and a molecular weight of 363.51 g/mol. Its IUPAC name is 5-pentyl-4-phenyl-N-(1-phenylethyl)-3,4-dihydropyrazole-2-carboxamide.
| Compound Name | 5-pentyl-4-phenyl-N-(1-phenylethyl)-3,4-dihydropyrazole-2-carboxamide |
|---|---|
| PubChem CID | 24863230 |
| Molecular Formula | C23H29N3O |
| Molecular Weight | 363.51 g/mol |
| Exact Mass | 363.23 |
| IUPAC Name | 5-pentyl-4-phenyl-N-(1-phenylethyl)-3,4-dihydropyrazole-2-carboxamide |
| SMILES | CCCCCC1=NN(C(=O)NC(C)c2ccccc2)CC1c1ccccc1 |
| InChI | InChI=1S/C23H29N3O/c1-3-4-7-16-22-21(20-14-10-6-11-15-20)17-26(25-22)23(27)24-18(2)19-12-8-5-9-13-19/h5-6,8-15,18,21H,3-4,7,16-17H2,1-2H3,(H,24,27) |
| InChIKey | QDBMRBWCVPGNAC-UHFFFAOYSA-N |
| XLogP | 5.49 |
| TPSA | 44.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.51 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|