C30H35N3O — CID 24863614
N-(2,2-diphenylpropyl)-5-pentyl-4-phenyl-3,4-dihydropyrazole-2-carboxamide (PubChem CID 24863614) has the molecular formula C30H35N3O and a molecular weight of 453.63 g/mol. Its IUPAC name is N-(2,2-diphenylpropyl)-5-pentyl-4-phenyl-3,4-dihydropyrazole-2-carboxamide.
| Compound Name | N-(2,2-diphenylpropyl)-5-pentyl-4-phenyl-3,4-dihydropyrazole-2-carboxamide |
|---|---|
| PubChem CID | 24863614 |
| Molecular Formula | C30H35N3O |
| Molecular Weight | 453.63 g/mol |
| Exact Mass | 453.28 |
| IUPAC Name | N-(2,2-diphenylpropyl)-5-pentyl-4-phenyl-3,4-dihydropyrazole-2-carboxamide |
| SMILES | CCCCCC1=NN(C(=O)NCC(C)(c2ccccc2)c2ccccc2)CC1c1ccccc1 |
| InChI | InChI=1S/C30H35N3O/c1-3-4-8-21-28-27(24-15-9-5-10-16-24)22-33(32-28)29(34)31-23-30(2,25-17-11-6-12-18-25)26-19-13-7-14-20-26/h5-7,9-20,27H,3-4,8,21-23H2,1-2H3,(H,31,34) |
| InChIKey | YVBXCEHFSATKTD-UHFFFAOYSA-N |
| XLogP | 6.74 |
| TPSA | 44.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.63 |
| LogP ≤ 5 | 6.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|