C23H23ClN2OS — CID 24862714
(3-chloro-1-benzothiophen-2-yl)-(5-pentyl-4-phenyl-3,4-dihydropyrazol-2-yl)methanone (PubChem CID 24862714) has the molecular formula C23H23ClN2OS and a molecular weight of 410.97 g/mol. Its IUPAC name is (3-chloro-1-benzothiophen-2-yl)-(5-pentyl-4-phenyl-3,4-dihydropyrazol-2-yl)methanone.
| Compound Name | (3-chloro-1-benzothiophen-2-yl)-(5-pentyl-4-phenyl-3,4-dihydropyrazol-2-yl)methanone |
|---|---|
| PubChem CID | 24862714 |
| Molecular Formula | C23H23ClN2OS |
| Molecular Weight | 410.97 g/mol |
| Exact Mass | 410.12 |
| IUPAC Name | (3-chloro-1-benzothiophen-2-yl)-(5-pentyl-4-phenyl-3,4-dihydropyrazol-2-yl)methanone |
| SMILES | CCCCCC1=NN(C(=O)c2sc3ccccc3c2Cl)CC1c1ccccc1 |
| InChI | InChI=1S/C23H23ClN2OS/c1-2-3-5-13-19-18(16-10-6-4-7-11-16)15-26(25-19)23(27)22-21(24)17-12-8-9-14-20(17)28-22/h4,6-12,14,18H,2-3,5,13,15H2,1H3 |
| InChIKey | AGHIDQUCQYSRDQ-UHFFFAOYSA-N |
| XLogP | 6.73 |
| TPSA | 32.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.97 |
| LogP ≤ 5 | 6.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|