C23H36N2O — CID 87257337
3,5,5-trimethyl-2-(5-pentyl-4-phenyl-3,4-dihydropyrazol-2-yl)hexanal (PubChem CID 87257337) has the molecular formula C23H36N2O and a molecular weight of 356.55 g/mol. Its IUPAC name is 3,5,5-trimethyl-2-(5-pentyl-4-phenyl-3,4-dihydropyrazol-2-yl)hexanal.
| Compound Name | 3,5,5-trimethyl-2-(5-pentyl-4-phenyl-3,4-dihydropyrazol-2-yl)hexanal |
|---|---|
| PubChem CID | 87257337 |
| Molecular Formula | C23H36N2O |
| Molecular Weight | 356.55 g/mol |
| Exact Mass | 356.28 |
| IUPAC Name | 3,5,5-trimethyl-2-(5-pentyl-4-phenyl-3,4-dihydropyrazol-2-yl)hexanal |
| SMILES | CCCCCC1=NN(C(C=O)C(C)CC(C)(C)C)CC1c1ccccc1 |
| InChI | InChI=1S/C23H36N2O/c1-6-7-9-14-21-20(19-12-10-8-11-13-19)16-25(24-21)22(17-26)18(2)15-23(3,4)5/h8,10-13,17-18,20,22H,6-7,9,14-16H2,1-5H3 |
| InChIKey | OVXHSTJDTMWYPX-UHFFFAOYSA-N |
| XLogP | 5.66 |
| TPSA | 32.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.55 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|