C14H14O2 — CID 6933089
(E)-1-[(1S,5S)-6-oxabicyclo[3.1.0]hexan-1-yl]-3-phenylprop-2-en-1-one (PubChem CID 6933089) has the molecular formula C14H14O2 and a molecular weight of 214.26 g/mol. Its IUPAC name is (E)-1-[(1S,5S)-6-oxabicyclo[3.1.0]hexan-1-yl]-3-phenylprop-2-en-1-one.
| Compound Name | (E)-1-[(1S,5S)-6-oxabicyclo[3.1.0]hexan-1-yl]-3-phenylprop-2-en-1-one |
|---|---|
| PubChem CID | 6933089 |
| Molecular Formula | C14H14O2 |
| Molecular Weight | 214.26 g/mol |
| Exact Mass | 214.10 |
| IUPAC Name | (E)-1-[(1S,5S)-6-oxabicyclo[3.1.0]hexan-1-yl]-3-phenylprop-2-en-1-one |
| SMILES | O=C(/C=C/c1ccccc1)[C@]12CCC[C@@H]1O2 |
| InChI | InChI=1S/C14H14O2/c15-12(14-10-4-7-13(14)16-14)9-8-11-5-2-1-3-6-11/h1-3,5-6,8-9,13H,4,7,10H2/b9-8+/t13-,14+/m0/s1 |
| InChIKey | NZXHLNNSFKUNFN-NYCDYWJRSA-N |
| XLogP | 2.59 |
| TPSA | 29.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.26 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|