C16H22N2O4 — CID 141179135
3-phenyl-1-(2,2,3-trimethoxypiperazin-1-yl)prop-2-en-1-one (PubChem CID 141179135) has the molecular formula C16H22N2O4 and a molecular weight of 306.36 g/mol. Its IUPAC name is 3-phenyl-1-(2,2,3-trimethoxypiperazin-1-yl)prop-2-en-1-one.
| Compound Name | 3-phenyl-1-(2,2,3-trimethoxypiperazin-1-yl)prop-2-en-1-one |
|---|---|
| PubChem CID | 141179135 |
| Molecular Formula | C16H22N2O4 |
| Molecular Weight | 306.36 g/mol |
| Exact Mass | 306.16 |
| IUPAC Name | 3-phenyl-1-(2,2,3-trimethoxypiperazin-1-yl)prop-2-en-1-one |
| SMILES | COC1NCCN(C(=O)C=Cc2ccccc2)C1(OC)OC |
| InChI | InChI=1S/C16H22N2O4/c1-20-15-16(21-2,22-3)18(12-11-17-15)14(19)10-9-13-7-5-4-6-8-13/h4-10,15,17H,11-12H2,1-3H3 |
| InChIKey | UIFGBWIQNXTJIX-UHFFFAOYSA-N |
| XLogP | 1.05 |
| TPSA | 60.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.36 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|