C16H22N2O4 — CID 67871205
3-phenyl-1-(3,4,5-trimethoxypiperazin-1-yl)prop-2-en-1-one (PubChem CID 67871205) has the molecular formula C16H22N2O4 and a molecular weight of 306.36 g/mol. Its IUPAC name is 3-phenyl-1-(3,4,5-trimethoxypiperazin-1-yl)prop-2-en-1-one.
| Compound Name | 3-phenyl-1-(3,4,5-trimethoxypiperazin-1-yl)prop-2-en-1-one |
|---|---|
| PubChem CID | 67871205 |
| Molecular Formula | C16H22N2O4 |
| Molecular Weight | 306.36 g/mol |
| Exact Mass | 306.16 |
| IUPAC Name | 3-phenyl-1-(3,4,5-trimethoxypiperazin-1-yl)prop-2-en-1-one |
| SMILES | COC1CN(C(=O)C=Cc2ccccc2)CC(OC)N1OC |
| InChI | InChI=1S/C16H22N2O4/c1-20-15-11-17(12-16(21-2)18(15)22-3)14(19)10-9-13-7-5-4-6-8-13/h4-10,15-16H,11-12H2,1-3H3 |
| InChIKey | KYJFHNZZANFICE-UHFFFAOYSA-N |
| XLogP | 1.35 |
| TPSA | 51.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.36 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|