C16H22N2O4S — CID 171140355
1-[(3R,4R)-4-hydroxy-1-(3-phenylprop-2-enoyl)pyrrolidin-3-yl]-N,N-dimethylmethanesulfonamide (PubChem CID 171140355) has the molecular formula C16H22N2O4S and a molecular weight of 338.43 g/mol. Its IUPAC name is 1-[(3R,4R)-4-hydroxy-1-(3-phenylprop-2-enoyl)pyrrolidin-3-yl]-N,N-dimethylmethanesulfonamide.
| Compound Name | 1-[(3R,4R)-4-hydroxy-1-(3-phenylprop-2-enoyl)pyrrolidin-3-yl]-N,N-dimethylmethanesulfonamide |
|---|---|
| PubChem CID | 171140355 |
| Molecular Formula | C16H22N2O4S |
| Molecular Weight | 338.43 g/mol |
| Exact Mass | 338.13 |
| IUPAC Name | 1-[(3R,4R)-4-hydroxy-1-(3-phenylprop-2-enoyl)pyrrolidin-3-yl]-N,N-dimethylmethanesulfonamide |
| SMILES | CN(C)S(=O)(=O)C[C@@H]1CN(C(=O)C=Cc2ccccc2)C[C@@H]1O |
| InChI | InChI=1S/C16H22N2O4S/c1-17(2)23(21,22)12-14-10-18(11-15(14)19)16(20)9-8-13-6-4-3-5-7-13/h3-9,14-15,19H,10-12H2,1-2H3/t14-,15-/m0/s1 |
| InChIKey | RCPZWPBFIOVKEY-GJZGRUSLSA-N |
| XLogP | 0.41 |
| TPSA | 77.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.43 |
| LogP ≤ 5 | 0.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|