C24H30O3 — CID 163019994
(8a-hydroxy-3a,6-dimethyl-1-propan-2-yl-1,4,7,8-tetrahydroazulen-4-yl) 3-phenylprop-2-enoate (PubChem CID 163019994) has the molecular formula C24H30O3 and a molecular weight of 366.50 g/mol. Its IUPAC name is (8a-hydroxy-3a,6-dimethyl-1-propan-2-yl-1,4,7,8-tetrahydroazulen-4-yl) 3-phenylprop-2-enoate.
| Compound Name | (8a-hydroxy-3a,6-dimethyl-1-propan-2-yl-1,4,7,8-tetrahydroazulen-4-yl) 3-phenylprop-2-enoate |
|---|---|
| PubChem CID | 163019994 |
| Molecular Formula | C24H30O3 |
| Molecular Weight | 366.50 g/mol |
| Exact Mass | 366.22 |
| IUPAC Name | (8a-hydroxy-3a,6-dimethyl-1-propan-2-yl-1,4,7,8-tetrahydroazulen-4-yl) 3-phenylprop-2-enoate |
| SMILES | CC1=CC(OC(=O)C=Cc2ccccc2)C2(C)C=CC(C(C)C)C2(O)CC1 |
| InChI | InChI=1S/C24H30O3/c1-17(2)20-13-14-23(4)21(16-18(3)12-15-24(20,23)26)27-22(25)11-10-19-8-6-5-7-9-19/h5-11,13-14,16-17,20-21,26H,12,15H2,1-4H3 |
| InChIKey | CSTQRRVKUOEJIE-UHFFFAOYSA-N |
| XLogP | 4.93 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.50 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|