C27H31ClO7 — CID 6708564
methyl 2-[(1S,5R,6R,11S,16R)-14-chloro-6-(furan-3-yl)-1,5,15,15-tetramethyl-8,17-dioxo-7,18-dioxapentacyclo[11.3.1.111,14.02,11.05,10]octadec-9-en-16-yl]acetate (PubChem CID 6708564) has the molecular formula C27H31ClO7 and a molecular weight of 502.99 g/mol. Its IUPAC name is methyl 2-[(1S,5R,6R,11S,16R)-14-chloro-6-(furan-3-yl)-1,5,15,15-tetramethyl-8,17-dioxo-7,18-dioxapentacyclo[11.3.1.111,14.02,11.05,10]octadec-9-en-16-yl]acetate.
| Compound Name | methyl 2-[(1S,5R,6R,11S,16R)-14-chloro-6-(furan-3-yl)-1,5,15,15-tetramethyl-8,17-dioxo-7,18-dioxapentacyclo[11.3.1.111,14.02,11.05,10]octadec-9-en-16-yl]acetate |
|---|---|
| PubChem CID | 6708564 |
| Molecular Formula | C27H31ClO7 |
| Molecular Weight | 502.99 g/mol |
| Exact Mass | 502.18 |
| IUPAC Name | methyl 2-[(1S,5R,6R,11S,16R)-14-chloro-6-(furan-3-yl)-1,5,15,15-tetramethyl-8,17-dioxo-7,18-dioxapentacyclo[11.3.1.111,14.02,11.05,10]octadec-9-en-16-yl]acetate |
| SMILES | COC(=O)C[C@H]1C(C)(C)C2(Cl)O[C@@]34CC2C(=O)[C@]1(C)C3CC[C@]1(C)C4=CC(=O)O[C@H]1c1ccoc1 |
| InChI | InChI=1S/C27H31ClO7/c1-23(2)17(10-19(29)32-5)25(4)16-6-8-24(3)18(11-20(30)34-22(24)14-7-9-33-13-14)26(16)12-15(21(25)31)27(23,28)35-26/h7,9,11,13,15-17,22H,6,8,10,12H2,1-5H3/t15?,16?,17-,22-,24+,25+,26-,27?/m0/s1 |
| InChIKey | FVXYCYOANPHZHB-ZSWFMMJVSA-N |
| XLogP | 4.74 |
| TPSA | 92.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.99 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|