C31H36O8 — CID 163106414
[(1R,2R,5R,6R,13S,14R,16S)-6-(furan-3-yl)-16-(2-methoxy-2-oxoethyl)-1,5,15,15-tetramethyl-8,17-dioxo-7-oxatetracyclo[11.3.1.02,11.05,10]heptadeca-9,11-dien-14-yl] 2-methylprop-2-enoate (PubChem CID 163106414) has the molecular formula C31H36O8 and a molecular weight of 536.62 g/mol. Its IUPAC name is [(1R,2R,5R,6R,13S,14R,16S)-6-(furan-3-yl)-16-(2-methoxy-2-oxoethyl)-1,5,15,15-tetramethyl-8,17-dioxo-7-oxatetracyclo[11.3.1.02,11.05,10]heptadeca-9,11-dien-14-yl] 2-methylprop-2-enoate.
| Compound Name | [(1R,2R,5R,6R,13S,14R,16S)-6-(furan-3-yl)-16-(2-methoxy-2-oxoethyl)-1,5,15,15-tetramethyl-8,17-dioxo-7-oxatetracyclo[11.3.1.02,11.05,10]heptadeca-9,11-dien-14-yl] 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 163106414 |
| Molecular Formula | C31H36O8 |
| Molecular Weight | 536.62 g/mol |
| Exact Mass | 536.24 |
| IUPAC Name | [(1R,2R,5R,6R,13S,14R,16S)-6-(furan-3-yl)-16-(2-methoxy-2-oxoethyl)-1,5,15,15-tetramethyl-8,17-dioxo-7-oxatetracyclo[11.3.1.02,11.05,10]heptadeca-9,11-dien-14-yl] 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)O[C@@H]1[C@@H]2C=C3C4=CC(=O)O[C@@H](c5ccoc5)[C@]4(C)CC[C@H]3[C@@](C)(C2=O)[C@@H](CC(=O)OC)C1(C)C |
| InChI | InChI=1S/C31H36O8/c1-16(2)28(35)39-27-19-12-18-20(31(6,25(19)34)22(29(27,3)4)14-23(32)36-7)8-10-30(5)21(18)13-24(33)38-26(30)17-9-11-37-15-17/h9,11-13,15,19-20,22,26-27H,1,8,10,14H2,2-7H3/t19-,20-,22+,26+,27-,30-,31-/m1/s1 |
| InChIKey | WITTXQPTGBKBPK-JBXABWEHSA-N |
| XLogP | 5.06 |
| TPSA | 109.11 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.62 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|