C31H34O8 — CID 102053662
[(1R,2S,5R,6R,14R,15R,20S)-6-(furan-3-yl)-1,5,15-trimethyl-8,18,21-trioxo-7,17-dioxapentacyclo[11.7.1.02,11.05,10.015,20]henicosa-9,11-dien-14-yl] (E)-2-methylbut-2-enoate (PubChem CID 102053662) has the molecular formula C31H34O8 and a molecular weight of 534.61 g/mol. Its IUPAC name is [(1R,2S,5R,6R,14R,15R,20S)-6-(furan-3-yl)-1,5,15-trimethyl-8,18,21-trioxo-7,17-dioxapentacyclo[11.7.1.02,11.05,10.015,20]henicosa-9,11-dien-14-yl] (E)-2-methylbut-2-enoate.
| Compound Name | [(1R,2S,5R,6R,14R,15R,20S)-6-(furan-3-yl)-1,5,15-trimethyl-8,18,21-trioxo-7,17-dioxapentacyclo[11.7.1.02,11.05,10.015,20]henicosa-9,11-dien-14-yl] (E)-2-methylbut-2-enoate |
|---|---|
| PubChem CID | 102053662 |
| Molecular Formula | C31H34O8 |
| Molecular Weight | 534.61 g/mol |
| Exact Mass | 534.23 |
| IUPAC Name | [(1R,2S,5R,6R,14R,15R,20S)-6-(furan-3-yl)-1,5,15-trimethyl-8,18,21-trioxo-7,17-dioxapentacyclo[11.7.1.02,11.05,10.015,20]henicosa-9,11-dien-14-yl] (E)-2-methylbut-2-enoate |
| SMILES | C/C=C(\C)C(=O)O[C@@H]1C2C=C3C4=CC(=O)O[C@@H](c5ccoc5)[C@]4(C)CC[C@@H]3[C@@](C)(C2=O)[C@H]2CC(=O)OC[C@]12C |
| InChI | InChI=1S/C31H34O8/c1-6-16(2)28(35)39-27-19-11-18-20(31(5,25(19)34)22-13-23(32)37-15-30(22,27)4)7-9-29(3)21(18)12-24(33)38-26(29)17-8-10-36-14-17/h6,8,10-12,14,19-20,22,26-27H,7,9,13,15H2,1-5H3/b16-6+/t19?,20-,22-,26-,27+,29+,30-,31+/m0/s1 |
| InChIKey | FDUMAJJXYLGAMH-UROPPFKLSA-N |
| XLogP | 4.81 |
| TPSA | 109.11 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.61 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|